C22H29N3O2 — CID 142235460
[(2Z,4E)-hepta-2,4-dien-4-yl] N-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]carbamate (PubChem CID 142235460) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is [(2Z,4E)-hepta-2,4-dien-4-yl] N-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]carbamate.
| Compound Name | [(2Z,4E)-hepta-2,4-dien-4-yl] N-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 142235460 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | [(2Z,4E)-hepta-2,4-dien-4-yl] N-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]carbamate |
| SMILES | C/C=C\C(=C/CC)OC(=O)Nc1cc(C(C)(C)C)nn1-c1ccc(C)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-7-9-18(10-8-2)27-21(26)23-20-15-19(22(4,5)6)24-25(20)17-13-11-16(3)12-14-17/h7,9-15H,8H2,1-6H3,(H,23,26)/b9-7-,18-10+ |
| InChIKey | XYJPMONQSSPQNH-HJYMNFMOSA-N |
| XLogP | 5.90 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|