C8H12O2S — CID 14223555
ethyl 3,4-dihydro-2H-thiopyran-3-carboxylate (PubChem CID 14223555) has the molecular formula C8H12O2S and a molecular weight of 172.25 g/mol. Its IUPAC name is ethyl 3,4-dihydro-2H-thiopyran-3-carboxylate.
| Compound Name | ethyl 3,4-dihydro-2H-thiopyran-3-carboxylate |
|---|---|
| PubChem CID | 14223555 |
| Molecular Formula | C8H12O2S |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | ethyl 3,4-dihydro-2H-thiopyran-3-carboxylate |
| SMILES | CCOC(=O)C1CC=CSC1 |
| InChI | InChI=1S/C8H12O2S/c1-2-10-8(9)7-4-3-5-11-6-7/h3,5,7H,2,4,6H2,1H3 |
| InChIKey | UALNDXRGMLLSFL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |