C20H27N — CID 142235558
4-[(Z,2E)-1-cyclohepta-1,3,6-trien-1-yl-2-ethylidenehex-3-enylidene]piperidine (PubChem CID 142235558) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is 4-[(Z,2E)-1-cyclohepta-1,3,6-trien-1-yl-2-ethylidenehex-3-enylidene]piperidine.
| Compound Name | 4-[(Z,2E)-1-cyclohepta-1,3,6-trien-1-yl-2-ethylidenehex-3-enylidene]piperidine |
|---|---|
| PubChem CID | 142235558 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 4-[(Z,2E)-1-cyclohepta-1,3,6-trien-1-yl-2-ethylidenehex-3-enylidene]piperidine |
| SMILES | C/C=C(\C=C/CC)C(C1=CC=CCC=C1)=C1CCNCC1 |
| InChI | InChI=1S/C20H27N/c1-3-5-10-17(4-2)20(19-13-15-21-16-14-19)18-11-8-6-7-9-12-18/h4-6,8-12,21H,3,7,13-16H2,1-2H3/b10-5-,17-4+ |
| InChIKey | BWQPAEXLLGQNHX-YRGYTBOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|