C16H15N3O3S — CID 142235706
4-[[5-(3-ethoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]benzene-1,2-diol (PubChem CID 142235706) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 4-[[5-(3-ethoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]benzene-1,2-diol.
| Compound Name | 4-[[5-(3-ethoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]benzene-1,2-diol |
|---|---|
| PubChem CID | 142235706 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 4-[[5-(3-ethoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]benzene-1,2-diol |
| SMILES | CCOc1cccc(-c2nnc(Nc3ccc(O)c(O)c3)s2)c1 |
| InChI | InChI=1S/C16H15N3O3S/c1-2-22-12-5-3-4-10(8-12)15-18-19-16(23-15)17-11-6-7-13(20)14(21)9-11/h3-9,20-21H,2H2,1H3,(H,17,19) |
| InChIKey | NWQJTQOQEFQSEY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|