About [(1S,2S)-1,2-dimethylcyclohexyl]-[(2R)-2-propylpyrrolidin-1-yl]methanone
[(1S,2S)-1,2-dimethylcyclohexyl]-[(2R)-2-propylpyrrolidin-1-yl]methanone (PubChem CID 14223666) has the molecular formula C16H29NO
and a molecular weight of 251.41 g/mol. Its IUPAC name is [(1S,2S)-1,2-dimethylcyclohexyl]-[(2R)-2-propylpyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | [(1S,2S)-1,2-dimethylcyclohexyl]-[(2R)-2-propylpyrrolidin-1-yl]methanone |
| PubChem CID | 14223666 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | [(1S,2S)-1,2-dimethylcyclohexyl]-[(2R)-2-propylpyrrolidin-1-yl]methanone |
| SMILES | CCC[C@@H]1CCCN1C(=O)[C@@]1(C)CCCC[C@@H]1C |
| InChI | InChI=1S/C16H29NO/c1-4-8-14-10-7-12-17(14)15(18)16(3)11-6-5-9-13(16)2/h13-14H,4-12H2,1-3H3/t13-,14+,16-/m0/s1 |
| InChIKey | OGAIDFKIQYCVNJ-LZWOXQAQSA-N |
| XLogP | 3.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1S,2S)-1,2-dimethylcyclohexyl]-[(2R)-2-propylpyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-1,2-dimethylcyclohexyl]-[(2R)-2-propylpyrrolidin-1-yl]methanone?
The IUPAC name of [(1S,2S)-1,2-dimethylcyclohexyl]-[(2R)-2-propylpyrrolidin-1-yl]methanone (CID 14223666) is [(1S,2S)-1,2-dimethylcyclohexyl]-[(2R)-2-propylpyrrolidin-1-yl]methanone.
What is the SMILES notation for [(1S,2S)-1,2-dimethylcyclohexyl]-[(2R)-2-propylpyrrolidin-1-yl]methanone?
The canonical SMILES for [(1S,2S)-1,2-dimethylcyclohexyl]-[(2R)-2-propylpyrrolidin-1-yl]methanone is CCC[C@@H]1CCCN1C(=O)[C@@]1(C)CCCC[C@@H]1C.
What is the InChIKey of [(1S,2S)-1,2-dimethylcyclohexyl]-[(2R)-2-propylpyrrolidin-1-yl]methanone?
The InChIKey is OGAIDFKIQYCVNJ-LZWOXQAQSA-N. The full InChI is InChI=1S/C16H29NO/c1-4-8-14-10-7-12-17(14)15(18)16(3)11-6-5-9-13(16)2/h13-14H,4-12H2,1-3H3/t13-,14+,16-/m0/s1.
What are the key properties of [(1S,2S)-1,2-dimethylcyclohexyl]-[(2R)-2-propylpyrrolidin-1-yl]methanone?
[(1S,2S)-1,2-dimethylcyclohexyl]-[(2R)-2-propylpyrrolidin-1-yl]methanone has a molecular weight of 251.41 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-1,2-dimethylcyclohexyl]-[(2R)-2-propylpyrrolidin-1-yl]methanone is sourced from PubChem (CID 14223666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).