C16H14N3O+ — CID 142236666
N-[(2-methylphenyl)methyl]-1,2-dihydrobenzimidazol-2-ylium-5-carboxamide (PubChem CID 142236666) has the molecular formula C16H14N3O+ and a molecular weight of 264.31 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]-1,2-dihydrobenzimidazol-2-ylium-5-carboxamide.
| Compound Name | N-[(2-methylphenyl)methyl]-1,2-dihydrobenzimidazol-2-ylium-5-carboxamide |
|---|---|
| PubChem CID | 142236666 |
| Molecular Formula | C16H14N3O+ |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-[(2-methylphenyl)methyl]-1,2-dihydrobenzimidazol-2-ylium-5-carboxamide |
| SMILES | Cc1ccccc1CNC(=O)c1ccc2c(c1)N=[C+]N2 |
| InChI | InChI=1S/C16H13N3O/c1-11-4-2-3-5-13(11)9-17-16(20)12-6-7-14-15(8-12)19-10-18-14/h2-8H,9H2,1H3,(H-,17,18,19,20)/p+1 |
| InChIKey | UVVHHRQAURCMKS-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|