C21H38N2 — CID 142237001
1-(3-ethylheptyl)-N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]piperidin-4-amine (PubChem CID 142237001) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is 1-(3-ethylheptyl)-N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]piperidin-4-amine.
| Compound Name | 1-(3-ethylheptyl)-N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 142237001 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | 1-(3-ethylheptyl)-N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]piperidin-4-amine |
| SMILES | C=C(/C=C\C=C/C)NC1CCN(CCC(CC)CCCC)CC1 |
| InChI | InChI=1S/C21H38N2/c1-5-8-10-11-19(4)22-21-14-17-23(18-15-21)16-13-20(7-3)12-9-6-2/h5,8,10-11,20-22H,4,6-7,9,12-18H2,1-3H3/b8-5-,11-10- |
| InChIKey | JDXDJBYNVWNIRG-QDKPKGLSSA-N |
| XLogP | 5.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|