About phenyl-(6-phenyl-2-pyridinyl)methanamine;prop-1-ene;(E)-2,3,6-trimethylhept-3-ene
phenyl-(6-phenyl-2-pyridinyl)methanamine;prop-1-ene;(E)-2,3,6-trimethylhept-3-ene (PubChem CID 142237417) has the molecular formula C31H42N2
and a molecular weight of 442.69 g/mol. Its IUPAC name is phenyl-(6-phenyl-2-pyridinyl)methanamine;prop-1-ene;(E)-2,3,6-trimethylhept-3-ene.
Molecular Properties
| Compound Name | phenyl-(6-phenyl-2-pyridinyl)methanamine;prop-1-ene;(E)-2,3,6-trimethylhept-3-ene |
| PubChem CID | 142237417 |
| Molecular Formula | C31H42N2 |
| Molecular Weight | 442.69 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | phenyl-(6-phenyl-2-pyridinyl)methanamine;prop-1-ene;(E)-2,3,6-trimethylhept-3-ene |
| SMILES | C/C(=C\CC(C)C)C(C)C.C=CC.NC(c1ccccc1)c1cccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H16N2.C10H20.C3H6/c19-18(15-10-5-2-6-11-15)17-13-7-12-16(20-17)14-8-3-1-4-9-14;1-8(2)6-7-10(5)9(3)4;1-3-2/h1-13,18H,19H2;7-9H,6H2,1-5H3;3H,1H2,2H3/b;10-7+; |
| InChIKey | LIWOYOAIECNLGO-PIHOZGLFSA-N |
| XLogP | 8.62 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.69 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze phenyl-(6-phenyl-2-pyridinyl)methanamine;prop-1-ene;(E)-2,3,6-trimethylhept-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(6-phenyl-2-pyridinyl)methanamine;prop-1-ene;(E)-2,3,6-trimethylhept-3-ene?
The IUPAC name of phenyl-(6-phenyl-2-pyridinyl)methanamine;prop-1-ene;(E)-2,3,6-trimethylhept-3-ene (CID 142237417) is phenyl-(6-phenyl-2-pyridinyl)methanamine;prop-1-ene;(E)-2,3,6-trimethylhept-3-ene.
What is the SMILES notation for phenyl-(6-phenyl-2-pyridinyl)methanamine;prop-1-ene;(E)-2,3,6-trimethylhept-3-ene?
The canonical SMILES for phenyl-(6-phenyl-2-pyridinyl)methanamine;prop-1-ene;(E)-2,3,6-trimethylhept-3-ene is C/C(=C\CC(C)C)C(C)C.C=CC.NC(c1ccccc1)c1cccc(-c2ccccc2)n1.
What is the InChIKey of phenyl-(6-phenyl-2-pyridinyl)methanamine;prop-1-ene;(E)-2,3,6-trimethylhept-3-ene?
The InChIKey is LIWOYOAIECNLGO-PIHOZGLFSA-N. The full InChI is InChI=1S/C18H16N2.C10H20.C3H6/c19-18(15-10-5-2-6-11-15)17-13-7-12-16(20-17)14-8-3-1-4-9-14;1-8(2)6-7-10(5)9(3)4;1-3-2/h1-13,18H,19H2;7-9H,6H2,1-5H3;3H,1H2,2H3/b;10-7+;.
What are the key properties of phenyl-(6-phenyl-2-pyridinyl)methanamine;prop-1-ene;(E)-2,3,6-trimethylhept-3-ene?
phenyl-(6-phenyl-2-pyridinyl)methanamine;prop-1-ene;(E)-2,3,6-trimethylhept-3-ene has a molecular weight of 442.69 g/mol, XLogP of 8.62, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(6-phenyl-2-pyridinyl)methanamine;prop-1-ene;(E)-2,3,6-trimethylhept-3-ene is sourced from PubChem (CID 142237417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).