About 2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline
2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline (PubChem CID 14223742) has the molecular formula C18H10Br5N
and a molecular weight of 639.81 g/mol. Its IUPAC name is 2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline.
Molecular Properties
| Compound Name | 2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline |
| PubChem CID | 14223742 |
| Molecular Formula | C18H10Br5N |
| Molecular Weight | 639.81 g/mol |
| Exact Mass | 634.67 |
| IUPAC Name | 2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline |
| SMILES | Brc1ccc(N(c2ccc(Br)cc2Br)c2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C18H10Br5N/c19-11-1-5-14(6-2-11)24(17-7-3-12(20)9-15(17)22)18-8-4-13(21)10-16(18)23/h1-10H |
| InChIKey | VFLKOFGZFZHDEI-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 639.81 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline?
The IUPAC name of 2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline (CID 14223742) is 2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline.
What is the SMILES notation for 2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline?
The canonical SMILES for 2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline is Brc1ccc(N(c2ccc(Br)cc2Br)c2ccc(Br)cc2Br)cc1.
What is the InChIKey of 2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline?
The InChIKey is VFLKOFGZFZHDEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10Br5N/c19-11-1-5-14(6-2-11)24(17-7-3-12(20)9-15(17)22)18-8-4-13(21)10-16(18)23/h1-10H.
What are the key properties of 2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline?
2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline has a molecular weight of 639.81 g/mol, XLogP of 8.97, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline is sourced from PubChem (CID 14223742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).