C14H15ClN2O — CID 14223762
(2'S,3S,3'R,5R)-1-chlorospiro[adamantane-4,4'-oxetane]-2',3'-dicarbonitrile (PubChem CID 14223762) has the molecular formula C14H15ClN2O and a molecular weight of 262.74 g/mol. Its IUPAC name is (2'S,3S,3'R,5R)-1-chlorospiro[adamantane-4,4'-oxetane]-2',3'-dicarbonitrile.
| Compound Name | (2'S,3S,3'R,5R)-1-chlorospiro[adamantane-4,4'-oxetane]-2',3'-dicarbonitrile |
|---|---|
| PubChem CID | 14223762 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | (2'S,3S,3'R,5R)-1-chlorospiro[adamantane-4,4'-oxetane]-2',3'-dicarbonitrile |
| SMILES | N#C[C@@H]1[C@@H](C#N)OC12[C@@H]1CC3C[C@H]2CC(Cl)(C3)C1 |
| InChI | InChI=1S/C14H15ClN2O/c15-13-3-8-1-9(4-13)14(10(2-8)5-13)11(6-16)12(7-17)18-14/h8-12H,1-5H2/t8?,9-,10+,11-,12-,13?,14?/m1/s1 |
| InChIKey | XIPXADFKZYKIOD-XULWYVIFSA-N |
| XLogP | 2.60 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|