About 1-(4-bromocyclohepta-1,3,5-trien-1-yl)ethanamine
1-(4-bromocyclohepta-1,3,5-trien-1-yl)ethanamine (PubChem CID 142237690) has the molecular formula C9H12BrN
and a molecular weight of 214.11 g/mol. Its IUPAC name is 1-(4-bromocyclohepta-1,3,5-trien-1-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(4-bromocyclohepta-1,3,5-trien-1-yl)ethanamine |
| PubChem CID | 142237690 |
| Molecular Formula | C9H12BrN |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 1-(4-bromocyclohepta-1,3,5-trien-1-yl)ethanamine |
| SMILES | CC(N)C1=CC=C(Br)C=CC1 |
| InChI | InChI=1S/C9H12BrN/c1-7(11)8-3-2-4-9(10)6-5-8/h2,4-7H,3,11H2,1H3 |
| InChIKey | OSCFMBNVOBQXTE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-bromocyclohepta-1,3,5-trien-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromocyclohepta-1,3,5-trien-1-yl)ethanamine?
The IUPAC name of 1-(4-bromocyclohepta-1,3,5-trien-1-yl)ethanamine (CID 142237690) is 1-(4-bromocyclohepta-1,3,5-trien-1-yl)ethanamine.
What is the SMILES notation for 1-(4-bromocyclohepta-1,3,5-trien-1-yl)ethanamine?
The canonical SMILES for 1-(4-bromocyclohepta-1,3,5-trien-1-yl)ethanamine is CC(N)C1=CC=C(Br)C=CC1.
What is the InChIKey of 1-(4-bromocyclohepta-1,3,5-trien-1-yl)ethanamine?
The InChIKey is OSCFMBNVOBQXTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrN/c1-7(11)8-3-2-4-9(10)6-5-8/h2,4-7H,3,11H2,1H3.
What are the key properties of 1-(4-bromocyclohepta-1,3,5-trien-1-yl)ethanamine?
1-(4-bromocyclohepta-1,3,5-trien-1-yl)ethanamine has a molecular weight of 214.11 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromocyclohepta-1,3,5-trien-1-yl)ethanamine is sourced from PubChem (CID 142237690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).