About N-cyclohexa-1,5-dien-1-yl-N-(1-methylpiperidin-4-yl)propanamide;hydrofluoride
N-cyclohexa-1,5-dien-1-yl-N-(1-methylpiperidin-4-yl)propanamide;hydrofluoride (PubChem CID 142238057) has the molecular formula C15H25FN2O
and a molecular weight of 268.38 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-N-(1-methylpiperidin-4-yl)propanamide;hydrofluoride.
Molecular Properties
| Compound Name | N-cyclohexa-1,5-dien-1-yl-N-(1-methylpiperidin-4-yl)propanamide;hydrofluoride |
| PubChem CID | 142238057 |
| Molecular Formula | C15H25FN2O |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-N-(1-methylpiperidin-4-yl)propanamide;hydrofluoride |
| SMILES | CCC(=O)N(C1=CCCC=C1)C1CCN(C)CC1.F |
| InChI | InChI=1S/C15H24N2O.FH/c1-3-15(18)17(13-7-5-4-6-8-13)14-9-11-16(2)12-10-14;/h5,7-8,14H,3-4,6,9-12H2,1-2H3;1H |
| InChIKey | RUVQZKZGPSADPN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclohexa-1,5-dien-1-yl-N-(1-methylpiperidin-4-yl)propanamide;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-1,5-dien-1-yl-N-(1-methylpiperidin-4-yl)propanamide;hydrofluoride?
The IUPAC name of N-cyclohexa-1,5-dien-1-yl-N-(1-methylpiperidin-4-yl)propanamide;hydrofluoride (CID 142238057) is N-cyclohexa-1,5-dien-1-yl-N-(1-methylpiperidin-4-yl)propanamide;hydrofluoride.
What is the SMILES notation for N-cyclohexa-1,5-dien-1-yl-N-(1-methylpiperidin-4-yl)propanamide;hydrofluoride?
The canonical SMILES for N-cyclohexa-1,5-dien-1-yl-N-(1-methylpiperidin-4-yl)propanamide;hydrofluoride is CCC(=O)N(C1=CCCC=C1)C1CCN(C)CC1.F.
What is the InChIKey of N-cyclohexa-1,5-dien-1-yl-N-(1-methylpiperidin-4-yl)propanamide;hydrofluoride?
The InChIKey is RUVQZKZGPSADPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O.FH/c1-3-15(18)17(13-7-5-4-6-8-13)14-9-11-16(2)12-10-14;/h5,7-8,14H,3-4,6,9-12H2,1-2H3;1H.
What are the key properties of N-cyclohexa-1,5-dien-1-yl-N-(1-methylpiperidin-4-yl)propanamide;hydrofluoride?
N-cyclohexa-1,5-dien-1-yl-N-(1-methylpiperidin-4-yl)propanamide;hydrofluoride has a molecular weight of 268.38 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-1,5-dien-1-yl-N-(1-methylpiperidin-4-yl)propanamide;hydrofluoride is sourced from PubChem (CID 142238057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).