C18H25N5O — CID 142238183
(3Z)-4-[2-amino-5-methyl-4-(2-methylpiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]penta-1,3-dien-2-ol (PubChem CID 142238183) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is (3Z)-4-[2-amino-5-methyl-4-(2-methylpiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]penta-1,3-dien-2-ol.
| Compound Name | (3Z)-4-[2-amino-5-methyl-4-(2-methylpiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]penta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 142238183 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | (3Z)-4-[2-amino-5-methyl-4-(2-methylpiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]penta-1,3-dien-2-ol |
| SMILES | C=C(O)/C=C(/C)c1[nH]c2nc(N)nc(N3CCCCC3C)c2c1C |
| InChI | InChI=1S/C18H25N5O/c1-10(9-12(3)24)15-13(4)14-16(20-15)21-18(19)22-17(14)23-8-6-5-7-11(23)2/h9,11,24H,3,5-8H2,1-2,4H3,(H3,19,20,21,22)/b10-9- |
| InChIKey | ISMSDKOFEQGAGX-KTKRTIGZSA-N |
| XLogP | 3.70 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|