About N-butyl-N-ethyl-N'-methylethanimidamide;2-(methylamino)-1H-indol-5-ol
N-butyl-N-ethyl-N'-methylethanimidamide;2-(methylamino)-1H-indol-5-ol (PubChem CID 142238188) has the molecular formula C18H30N4O
and a molecular weight of 318.47 g/mol. Its IUPAC name is N-butyl-N-ethyl-N'-methylethanimidamide;2-(methylamino)-1H-indol-5-ol.
Molecular Properties
| Compound Name | N-butyl-N-ethyl-N'-methylethanimidamide;2-(methylamino)-1H-indol-5-ol |
| PubChem CID | 142238188 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | N-butyl-N-ethyl-N'-methylethanimidamide;2-(methylamino)-1H-indol-5-ol |
| SMILES | CCCCN(CC)/C(C)=N/C.CNc1cc2cc(O)ccc2[nH]1 |
| InChI | InChI=1S/C9H10N2O.C9H20N2/c1-10-9-5-6-4-7(12)2-3-8(6)11-9;1-5-7-8-11(6-2)9(3)10-4/h2-5,10-12H,1H3;5-8H2,1-4H3/b;10-9+ |
| InChIKey | MOCGNXNKCVAYAS-GMOHPMBGSA-N |
| XLogP | 4.07 |
| TPSA | 63.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N-ethyl-N'-methylethanimidamide;2-(methylamino)-1H-indol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-ethyl-N'-methylethanimidamide;2-(methylamino)-1H-indol-5-ol?
The IUPAC name of N-butyl-N-ethyl-N'-methylethanimidamide;2-(methylamino)-1H-indol-5-ol (CID 142238188) is N-butyl-N-ethyl-N'-methylethanimidamide;2-(methylamino)-1H-indol-5-ol.
What is the SMILES notation for N-butyl-N-ethyl-N'-methylethanimidamide;2-(methylamino)-1H-indol-5-ol?
The canonical SMILES for N-butyl-N-ethyl-N'-methylethanimidamide;2-(methylamino)-1H-indol-5-ol is CCCCN(CC)/C(C)=N/C.CNc1cc2cc(O)ccc2[nH]1.
What is the InChIKey of N-butyl-N-ethyl-N'-methylethanimidamide;2-(methylamino)-1H-indol-5-ol?
The InChIKey is MOCGNXNKCVAYAS-GMOHPMBGSA-N. The full InChI is InChI=1S/C9H10N2O.C9H20N2/c1-10-9-5-6-4-7(12)2-3-8(6)11-9;1-5-7-8-11(6-2)9(3)10-4/h2-5,10-12H,1H3;5-8H2,1-4H3/b;10-9+.
What are the key properties of N-butyl-N-ethyl-N'-methylethanimidamide;2-(methylamino)-1H-indol-5-ol?
N-butyl-N-ethyl-N'-methylethanimidamide;2-(methylamino)-1H-indol-5-ol has a molecular weight of 318.47 g/mol, XLogP of 4.07, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-ethyl-N'-methylethanimidamide;2-(methylamino)-1H-indol-5-ol is sourced from PubChem (CID 142238188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).