C12H23N3 — CID 142238227
N'-(3-methyl-3,6-dihydro-2H-azepin-7-yl)-N-propylethane-1,2-diamine (PubChem CID 142238227) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is N'-(3-methyl-3,6-dihydro-2H-azepin-7-yl)-N-propylethane-1,2-diamine.
| Compound Name | N'-(3-methyl-3,6-dihydro-2H-azepin-7-yl)-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 142238227 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | N'-(3-methyl-3,6-dihydro-2H-azepin-7-yl)-N-propylethane-1,2-diamine |
| SMILES | CCCNCCNC1=NCC(C)C=CC1 |
| InChI | InChI=1S/C12H23N3/c1-3-7-13-8-9-14-12-6-4-5-11(2)10-15-12/h4-5,11,13H,3,6-10H2,1-2H3,(H,14,15) |
| InChIKey | VHOBPRLUSHXULB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|