About tert-butyl 2-(ethylideneamino)propanoate;ethane;2-methylpropane
tert-butyl 2-(ethylideneamino)propanoate;ethane;2-methylpropane (PubChem CID 142238339) has the molecular formula C15H33NO2
and a molecular weight of 259.43 g/mol. Its IUPAC name is tert-butyl 2-(ethylideneamino)propanoate;ethane;2-methylpropane.
Molecular Properties
| Compound Name | tert-butyl 2-(ethylideneamino)propanoate;ethane;2-methylpropane |
| PubChem CID | 142238339 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | tert-butyl 2-(ethylideneamino)propanoate;ethane;2-methylpropane |
| SMILES | C/C=N/C(C)C(=O)OC(C)(C)C.CC.CC(C)C |
| InChI | InChI=1S/C9H17NO2.C4H10.C2H6/c1-6-10-7(2)8(11)12-9(3,4)5;1-4(2)3;1-2/h6-7H,1-5H3;4H,1-3H3;1-2H3/b10-6+;; |
| InChIKey | KUQXDDFCKMVIHA-DOLBFOAYSA-N |
| XLogP | 4.50 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(ethylideneamino)propanoate;ethane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(ethylideneamino)propanoate;ethane;2-methylpropane?
The IUPAC name of tert-butyl 2-(ethylideneamino)propanoate;ethane;2-methylpropane (CID 142238339) is tert-butyl 2-(ethylideneamino)propanoate;ethane;2-methylpropane.
What is the SMILES notation for tert-butyl 2-(ethylideneamino)propanoate;ethane;2-methylpropane?
The canonical SMILES for tert-butyl 2-(ethylideneamino)propanoate;ethane;2-methylpropane is C/C=N/C(C)C(=O)OC(C)(C)C.CC.CC(C)C.
What is the InChIKey of tert-butyl 2-(ethylideneamino)propanoate;ethane;2-methylpropane?
The InChIKey is KUQXDDFCKMVIHA-DOLBFOAYSA-N. The full InChI is InChI=1S/C9H17NO2.C4H10.C2H6/c1-6-10-7(2)8(11)12-9(3,4)5;1-4(2)3;1-2/h6-7H,1-5H3;4H,1-3H3;1-2H3/b10-6+;;.
What are the key properties of tert-butyl 2-(ethylideneamino)propanoate;ethane;2-methylpropane?
tert-butyl 2-(ethylideneamino)propanoate;ethane;2-methylpropane has a molecular weight of 259.43 g/mol, XLogP of 4.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(ethylideneamino)propanoate;ethane;2-methylpropane is sourced from PubChem (CID 142238339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).