C15H21NO — CID 142238586
(3Z,5E)-4-(butan-2-ylideneamino)-5-[(Z)-prop-1-enyl]octa-3,5,7-trien-2-one (PubChem CID 142238586) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (3Z,5E)-4-(butan-2-ylideneamino)-5-[(Z)-prop-1-enyl]octa-3,5,7-trien-2-one.
| Compound Name | (3Z,5E)-4-(butan-2-ylideneamino)-5-[(Z)-prop-1-enyl]octa-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 142238586 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (3Z,5E)-4-(butan-2-ylideneamino)-5-[(Z)-prop-1-enyl]octa-3,5,7-trien-2-one |
| SMILES | C=C/C=C(\C=C/C)C(=C/C(C)=O)/N=C(\C)CC |
| InChI | InChI=1S/C15H21NO/c1-6-9-14(10-7-2)15(11-13(5)17)16-12(4)8-3/h6-7,9-11H,1,8H2,2-5H3/b10-7-,14-9+,15-11-,16-12+ |
| InChIKey | SYDOARKQRKESRG-BZJGWDIKSA-N |
| XLogP | 4.02 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|