C14H25NO3 — CID 142238924
(2R,5R)-2-ethyl-5-[[(2E,4Z)-5-hydroxy-2-methylpenta-2,4-dienyl]amino]hexanoic acid (PubChem CID 142238924) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is (2R,5R)-2-ethyl-5-[[(2E,4Z)-5-hydroxy-2-methylpenta-2,4-dienyl]amino]hexanoic acid.
| Compound Name | (2R,5R)-2-ethyl-5-[[(2E,4Z)-5-hydroxy-2-methylpenta-2,4-dienyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 142238924 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (2R,5R)-2-ethyl-5-[[(2E,4Z)-5-hydroxy-2-methylpenta-2,4-dienyl]amino]hexanoic acid |
| SMILES | CCC(CC[C@@H](C)NC/C(C)=C/C=C\O)C(=O)O |
| InChI | InChI=1S/C14H25NO3/c1-4-13(14(17)18)8-7-12(3)15-10-11(2)6-5-9-16/h5-6,9,12-13,15-16H,4,7-8,10H2,1-3H3,(H,17,18)/b9-5-,11-6+/t12-,13?/m1/s1 |
| InChIKey | LFXOXQUQIYBVBY-STROGUDESA-N |
| XLogP | 2.87 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|