About acetylene;ethane;(2Z,5E)-N-methyl-5-morpholin-4-ylhepta-2,5-dien-1-amine
acetylene;ethane;(2Z,5E)-N-methyl-5-morpholin-4-ylhepta-2,5-dien-1-amine (PubChem CID 142239070) has the molecular formula C16H30N2O
and a molecular weight of 266.43 g/mol. Its IUPAC name is acetylene;ethane;(2Z,5E)-N-methyl-5-morpholin-4-ylhepta-2,5-dien-1-amine.
Molecular Properties
| Compound Name | acetylene;ethane;(2Z,5E)-N-methyl-5-morpholin-4-ylhepta-2,5-dien-1-amine |
| PubChem CID | 142239070 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | acetylene;ethane;(2Z,5E)-N-methyl-5-morpholin-4-ylhepta-2,5-dien-1-amine |
| SMILES | C#C.C/C=C(\C/C=C\CNC)N1CCOCC1.CC |
| InChI | InChI=1S/C12H22N2O.C2H6.C2H2/c1-3-12(6-4-5-7-13-2)14-8-10-15-11-9-14;2*1-2/h3-5,13H,6-11H2,1-2H3;1-2H3;1-2H/b5-4-,12-3+;; |
| InChIKey | QNOVCKPHPIRQDH-OYFWBJFYSA-N |
| XLogP | 2.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;ethane;(2Z,5E)-N-methyl-5-morpholin-4-ylhepta-2,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;ethane;(2Z,5E)-N-methyl-5-morpholin-4-ylhepta-2,5-dien-1-amine?
The IUPAC name of acetylene;ethane;(2Z,5E)-N-methyl-5-morpholin-4-ylhepta-2,5-dien-1-amine (CID 142239070) is acetylene;ethane;(2Z,5E)-N-methyl-5-morpholin-4-ylhepta-2,5-dien-1-amine.
What is the SMILES notation for acetylene;ethane;(2Z,5E)-N-methyl-5-morpholin-4-ylhepta-2,5-dien-1-amine?
The canonical SMILES for acetylene;ethane;(2Z,5E)-N-methyl-5-morpholin-4-ylhepta-2,5-dien-1-amine is C#C.C/C=C(\C/C=C\CNC)N1CCOCC1.CC.
What is the InChIKey of acetylene;ethane;(2Z,5E)-N-methyl-5-morpholin-4-ylhepta-2,5-dien-1-amine?
The InChIKey is QNOVCKPHPIRQDH-OYFWBJFYSA-N. The full InChI is InChI=1S/C12H22N2O.C2H6.C2H2/c1-3-12(6-4-5-7-13-2)14-8-10-15-11-9-14;2*1-2/h3-5,13H,6-11H2,1-2H3;1-2H3;1-2H/b5-4-,12-3+;;.
What are the key properties of acetylene;ethane;(2Z,5E)-N-methyl-5-morpholin-4-ylhepta-2,5-dien-1-amine?
acetylene;ethane;(2Z,5E)-N-methyl-5-morpholin-4-ylhepta-2,5-dien-1-amine has a molecular weight of 266.43 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;ethane;(2Z,5E)-N-methyl-5-morpholin-4-ylhepta-2,5-dien-1-amine is sourced from PubChem (CID 142239070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).