About methanamine;2-methylpropyl (NZ)-N-(thiophen-3-ylmethylidene)carbamate
methanamine;2-methylpropyl (NZ)-N-(thiophen-3-ylmethylidene)carbamate (PubChem CID 142239486) has the molecular formula C11H18N2O2S
and a molecular weight of 242.34 g/mol. Its IUPAC name is methanamine;2-methylpropyl (NZ)-N-(thiophen-3-ylmethylidene)carbamate.
Molecular Properties
| Compound Name | methanamine;2-methylpropyl (NZ)-N-(thiophen-3-ylmethylidene)carbamate |
| PubChem CID | 142239486 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | methanamine;2-methylpropyl (NZ)-N-(thiophen-3-ylmethylidene)carbamate |
| SMILES | CC(C)COC(=O)/N=C\c1ccsc1.CN |
| InChI | InChI=1S/C10H13NO2S.CH5N/c1-8(2)6-13-10(12)11-5-9-3-4-14-7-9;1-2/h3-5,7-8H,6H2,1-2H3;2H2,1H3/b11-5-; |
| InChIKey | QSLHWVJSGQEDIG-JIBDQCPFSA-N |
| XLogP | 2.53 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methanamine;2-methylpropyl (NZ)-N-(thiophen-3-ylmethylidene)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;2-methylpropyl (NZ)-N-(thiophen-3-ylmethylidene)carbamate?
The IUPAC name of methanamine;2-methylpropyl (NZ)-N-(thiophen-3-ylmethylidene)carbamate (CID 142239486) is methanamine;2-methylpropyl (NZ)-N-(thiophen-3-ylmethylidene)carbamate.
What is the SMILES notation for methanamine;2-methylpropyl (NZ)-N-(thiophen-3-ylmethylidene)carbamate?
The canonical SMILES for methanamine;2-methylpropyl (NZ)-N-(thiophen-3-ylmethylidene)carbamate is CC(C)COC(=O)/N=C\c1ccsc1.CN.
What is the InChIKey of methanamine;2-methylpropyl (NZ)-N-(thiophen-3-ylmethylidene)carbamate?
The InChIKey is QSLHWVJSGQEDIG-JIBDQCPFSA-N. The full InChI is InChI=1S/C10H13NO2S.CH5N/c1-8(2)6-13-10(12)11-5-9-3-4-14-7-9;1-2/h3-5,7-8H,6H2,1-2H3;2H2,1H3/b11-5-;.
What are the key properties of methanamine;2-methylpropyl (NZ)-N-(thiophen-3-ylmethylidene)carbamate?
methanamine;2-methylpropyl (NZ)-N-(thiophen-3-ylmethylidene)carbamate has a molecular weight of 242.34 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;2-methylpropyl (NZ)-N-(thiophen-3-ylmethylidene)carbamate is sourced from PubChem (CID 142239486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).