About 3-amino-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione;ethane
3-amino-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione;ethane (PubChem CID 142239544) has the molecular formula C14H28N2O2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 3-amino-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione;ethane.
Molecular Properties
| Compound Name | 3-amino-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione;ethane |
| PubChem CID | 142239544 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 3-amino-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione;ethane |
| SMILES | CC.CC(C)(C)C(=O)C(N)CC(=O)N1CCCC1 |
| InChI | InChI=1S/C12H22N2O2.C2H6/c1-12(2,3)11(16)9(13)8-10(15)14-6-4-5-7-14;1-2/h9H,4-8,13H2,1-3H3;1-2H3 |
| InChIKey | LICQDQNOZVTHIE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione;ethane?
The IUPAC name of 3-amino-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione;ethane (CID 142239544) is 3-amino-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione;ethane.
What is the SMILES notation for 3-amino-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione;ethane?
The canonical SMILES for 3-amino-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione;ethane is CC.CC(C)(C)C(=O)C(N)CC(=O)N1CCCC1.
What is the InChIKey of 3-amino-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione;ethane?
The InChIKey is LICQDQNOZVTHIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2.C2H6/c1-12(2,3)11(16)9(13)8-10(15)14-6-4-5-7-14;1-2/h9H,4-8,13H2,1-3H3;1-2H3.
What are the key properties of 3-amino-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione;ethane?
3-amino-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione;ethane has a molecular weight of 256.39 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione;ethane is sourced from PubChem (CID 142239544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).