C14H21ClN2 — CID 142239812
(2R)-1-[(4-chlorophenyl)methyl]-2,4,5-trimethylpiperazine (PubChem CID 142239812) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is (2R)-1-[(4-chlorophenyl)methyl]-2,4,5-trimethylpiperazine.
| Compound Name | (2R)-1-[(4-chlorophenyl)methyl]-2,4,5-trimethylpiperazine |
|---|---|
| PubChem CID | 142239812 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2R)-1-[(4-chlorophenyl)methyl]-2,4,5-trimethylpiperazine |
| SMILES | CC1CN(Cc2ccc(Cl)cc2)[C@H](C)CN1C |
| InChI | InChI=1S/C14H21ClN2/c1-11-9-17(12(2)8-16(11)3)10-13-4-6-14(15)7-5-13/h4-7,11-12H,8-10H2,1-3H3/t11?,12-/m1/s1 |
| InChIKey | IYOOOMHGSCZEOA-PIJUOVFKSA-N |
| XLogP | 2.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |