C10H13N5 — CID 142240124
4-(2-methylphenyl)-1H-1,3,5-triazine-2,4-diamine (PubChem CID 142240124) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 4-(2-methylphenyl)-1H-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-(2-methylphenyl)-1H-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 142240124 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 4-(2-methylphenyl)-1H-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccccc1C1(N)N=CNC(N)=N1 |
| InChI | InChI=1S/C10H13N5/c1-7-4-2-3-5-8(7)10(12)14-6-13-9(11)15-10/h2-6H,12H2,1H3,(H3,11,13,14,15) |
| InChIKey | PCDPVZHNWZBKFG-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |