C32H42O — CID 142240176
2-(5-benzhydrylcyclohepten-1-yl)-1-[(1R)-4-ethylcyclooctyl]ethanone (PubChem CID 142240176) has the molecular formula C32H42O and a molecular weight of 442.69 g/mol. Its IUPAC name is 2-(5-benzhydrylcyclohepten-1-yl)-1-[(1R)-4-ethylcyclooctyl]ethanone.
| Compound Name | 2-(5-benzhydrylcyclohepten-1-yl)-1-[(1R)-4-ethylcyclooctyl]ethanone |
|---|---|
| PubChem CID | 142240176 |
| Molecular Formula | C32H42O |
| Molecular Weight | 442.69 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | 2-(5-benzhydrylcyclohepten-1-yl)-1-[(1R)-4-ethylcyclooctyl]ethanone |
| SMILES | CCC1CCCC[C@@H](C(=O)CC2=CCCC(C(c3ccccc3)c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C32H42O/c1-2-25-12-9-10-14-27(22-20-25)31(33)24-26-13-11-19-30(23-21-26)32(28-15-5-3-6-16-28)29-17-7-4-8-18-29/h3-8,13,15-18,25,27,30,32H,2,9-12,14,19-24H2,1H3/t25?,27-,30?/m1/s1 |
| InChIKey | BUSYFFQRHPVRAQ-PGZNCVQKSA-N |
| XLogP | 8.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.69 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|