C12H18O2S — CID 142240814
ethyl 2-[(3E,5Z)-octa-1,3,5-trien-4-yl]sulfanylacetate (PubChem CID 142240814) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is ethyl 2-[(3E,5Z)-octa-1,3,5-trien-4-yl]sulfanylacetate.
| Compound Name | ethyl 2-[(3E,5Z)-octa-1,3,5-trien-4-yl]sulfanylacetate |
|---|---|
| PubChem CID | 142240814 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | ethyl 2-[(3E,5Z)-octa-1,3,5-trien-4-yl]sulfanylacetate |
| SMILES | C=C/C=C(\C=C/CC)SCC(=O)OCC |
| InChI | InChI=1S/C12H18O2S/c1-4-7-9-11(8-5-2)15-10-12(13)14-6-3/h5,7-9H,2,4,6,10H2,1,3H3/b9-7-,11-8+ |
| InChIKey | WKPWVODCURTTCF-BYSFRFKNSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|