C21H33N3O4 — CID 142241817
N-[2-hydroxy-3-[(3-methoxyphenyl)methylamino]propyl]-5-oxo-5-piperidin-1-ylpentanamide (PubChem CID 142241817) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is N-[2-hydroxy-3-[(3-methoxyphenyl)methylamino]propyl]-5-oxo-5-piperidin-1-ylpentanamide.
| Compound Name | N-[2-hydroxy-3-[(3-methoxyphenyl)methylamino]propyl]-5-oxo-5-piperidin-1-ylpentanamide |
|---|---|
| PubChem CID | 142241817 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | N-[2-hydroxy-3-[(3-methoxyphenyl)methylamino]propyl]-5-oxo-5-piperidin-1-ylpentanamide |
| SMILES | COc1cccc(CNCC(O)CNC(=O)CCCC(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C21H33N3O4/c1-28-19-8-5-7-17(13-19)14-22-15-18(25)16-23-20(26)9-6-10-21(27)24-11-3-2-4-12-24/h5,7-8,13,18,22,25H,2-4,6,9-12,14-16H2,1H3,(H,23,26) |
| InChIKey | KYPRDFXLADCFCT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |