C26H31N3O2 — CID 142242234
N-[3-aminooxy-4-[(3-ethylphenyl)methylamino]butan-2-yl]-3-phenylbenzamide (PubChem CID 142242234) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[3-aminooxy-4-[(3-ethylphenyl)methylamino]butan-2-yl]-3-phenylbenzamide.
| Compound Name | N-[3-aminooxy-4-[(3-ethylphenyl)methylamino]butan-2-yl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 142242234 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-[3-aminooxy-4-[(3-ethylphenyl)methylamino]butan-2-yl]-3-phenylbenzamide |
| SMILES | CCc1cccc(CNCC(ON)C(C)NC(=O)c2cccc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C26H31N3O2/c1-3-20-9-7-10-21(15-20)17-28-18-25(31-27)19(2)29-26(30)24-14-8-13-23(16-24)22-11-5-4-6-12-22/h4-16,19,25,28H,3,17-18,27H2,1-2H3,(H,29,30) |
| InChIKey | KLDSZQNZSQBPQP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|