About 2-phenylsulfanylnonanal
2-phenylsulfanylnonanal (PubChem CID 14224247) has the molecular formula C15H22OS
and a molecular weight of 250.41 g/mol. Its IUPAC name is 2-phenylsulfanylnonanal.
Molecular Properties
| Compound Name | 2-phenylsulfanylnonanal |
| PubChem CID | 14224247 |
| Molecular Formula | C15H22OS |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-phenylsulfanylnonanal |
| SMILES | CCCCCCCC(C=O)Sc1ccccc1 |
| InChI | InChI=1S/C15H22OS/c1-2-3-4-5-7-12-15(13-16)17-14-10-8-6-9-11-14/h6,8-11,13,15H,2-5,7,12H2,1H3 |
| InChIKey | ISIRACMJVZTIHM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylsulfanylnonanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanylnonanal?
The IUPAC name of 2-phenylsulfanylnonanal (CID 14224247) is 2-phenylsulfanylnonanal.
What is the SMILES notation for 2-phenylsulfanylnonanal?
The canonical SMILES for 2-phenylsulfanylnonanal is CCCCCCCC(C=O)Sc1ccccc1.
What is the InChIKey of 2-phenylsulfanylnonanal?
The InChIKey is ISIRACMJVZTIHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22OS/c1-2-3-4-5-7-12-15(13-16)17-14-10-8-6-9-11-14/h6,8-11,13,15H,2-5,7,12H2,1H3.
What are the key properties of 2-phenylsulfanylnonanal?
2-phenylsulfanylnonanal has a molecular weight of 250.41 g/mol, XLogP of 4.71, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanylnonanal is sourced from PubChem (CID 14224247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).