About N-butyl-N,7-dimethylisoquinolin-1-amine
N-butyl-N,7-dimethylisoquinolin-1-amine (PubChem CID 142242673) has the molecular formula C15H20N2
and a molecular weight of 228.34 g/mol. Its IUPAC name is N-butyl-N,7-dimethylisoquinolin-1-amine.
Molecular Properties
| Compound Name | N-butyl-N,7-dimethylisoquinolin-1-amine |
| PubChem CID | 142242673 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | N-butyl-N,7-dimethylisoquinolin-1-amine |
| SMILES | CCCCN(C)c1nccc2ccc(C)cc12 |
| InChI | InChI=1S/C15H20N2/c1-4-5-10-17(3)15-14-11-12(2)6-7-13(14)8-9-16-15/h6-9,11H,4-5,10H2,1-3H3 |
| InChIKey | NSLUYAKKHLIUPF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butyl-N,7-dimethylisoquinolin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N,7-dimethylisoquinolin-1-amine?
The IUPAC name of N-butyl-N,7-dimethylisoquinolin-1-amine (CID 142242673) is N-butyl-N,7-dimethylisoquinolin-1-amine.
What is the SMILES notation for N-butyl-N,7-dimethylisoquinolin-1-amine?
The canonical SMILES for N-butyl-N,7-dimethylisoquinolin-1-amine is CCCCN(C)c1nccc2ccc(C)cc12.
What is the InChIKey of N-butyl-N,7-dimethylisoquinolin-1-amine?
The InChIKey is NSLUYAKKHLIUPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2/c1-4-5-10-17(3)15-14-11-12(2)6-7-13(14)8-9-16-15/h6-9,11H,4-5,10H2,1-3H3.
What are the key properties of N-butyl-N,7-dimethylisoquinolin-1-amine?
N-butyl-N,7-dimethylisoquinolin-1-amine has a molecular weight of 228.34 g/mol, XLogP of 3.78, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N,7-dimethylisoquinolin-1-amine is sourced from PubChem (CID 142242673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).