About 4-chloro-3-methylcyclohexa-3,5-diene-1,2-diimine;ethane
4-chloro-3-methylcyclohexa-3,5-diene-1,2-diimine;ethane (PubChem CID 142242917) has the molecular formula C9H13ClN2
and a molecular weight of 184.67 g/mol. Its IUPAC name is 4-chloro-3-methylcyclohexa-3,5-diene-1,2-diimine;ethane.
Molecular Properties
| Compound Name | 4-chloro-3-methylcyclohexa-3,5-diene-1,2-diimine;ethane |
| PubChem CID | 142242917 |
| Molecular Formula | C9H13ClN2 |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 4-chloro-3-methylcyclohexa-3,5-diene-1,2-diimine;ethane |
| SMILES | CC.[H]/N=C1/C(C)=C(Cl)C=C/C1=N\[H] |
| InChI | InChI=1S/C7H7ClN2.C2H6/c1-4-5(8)2-3-6(9)7(4)10;1-2/h2-3,9-10H,1H3;1-2H3/b9-6+,10-7-; |
| InChIKey | BTNOBORXLIBUSF-LGRXGRCOSA-N |
| XLogP | 3.13 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-methylcyclohexa-3,5-diene-1,2-diimine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-methylcyclohexa-3,5-diene-1,2-diimine;ethane?
The IUPAC name of 4-chloro-3-methylcyclohexa-3,5-diene-1,2-diimine;ethane (CID 142242917) is 4-chloro-3-methylcyclohexa-3,5-diene-1,2-diimine;ethane.
What is the SMILES notation for 4-chloro-3-methylcyclohexa-3,5-diene-1,2-diimine;ethane?
The canonical SMILES for 4-chloro-3-methylcyclohexa-3,5-diene-1,2-diimine;ethane is CC.[H]/N=C1/C(C)=C(Cl)C=C/C1=N\[H].
What is the InChIKey of 4-chloro-3-methylcyclohexa-3,5-diene-1,2-diimine;ethane?
The InChIKey is BTNOBORXLIBUSF-LGRXGRCOSA-N. The full InChI is InChI=1S/C7H7ClN2.C2H6/c1-4-5(8)2-3-6(9)7(4)10;1-2/h2-3,9-10H,1H3;1-2H3/b9-6+,10-7-;.
What are the key properties of 4-chloro-3-methylcyclohexa-3,5-diene-1,2-diimine;ethane?
4-chloro-3-methylcyclohexa-3,5-diene-1,2-diimine;ethane has a molecular weight of 184.67 g/mol, XLogP of 3.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-methylcyclohexa-3,5-diene-1,2-diimine;ethane is sourced from PubChem (CID 142242917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).