About 2-[2-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-3-(trifluoromethyl)pyridine
2-[2-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-3-(trifluoromethyl)pyridine (PubChem CID 142242953) has the molecular formula C17H13Cl3F3NO3
and a molecular weight of 442.65 g/mol. Its IUPAC name is 2-[2-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-3-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 2-[2-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-3-(trifluoromethyl)pyridine |
| PubChem CID | 142242953 |
| Molecular Formula | C17H13Cl3F3NO3 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 440.99 |
| IUPAC Name | 2-[2-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-3-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cccnc1OCCOc1ccc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C17H13Cl3F3NO3/c18-13-10-11(25-7-5-15(19)20)3-4-14(13)26-8-9-27-16-12(17(21,22)23)2-1-6-24-16/h1-6,10H,7-9H2 |
| InChIKey | FSQAXLPBYUQLLM-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-3-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-3-(trifluoromethyl)pyridine?
The IUPAC name of 2-[2-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-3-(trifluoromethyl)pyridine (CID 142242953) is 2-[2-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-3-(trifluoromethyl)pyridine.
What is the SMILES notation for 2-[2-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-3-(trifluoromethyl)pyridine?
The canonical SMILES for 2-[2-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-3-(trifluoromethyl)pyridine is FC(F)(F)c1cccnc1OCCOc1ccc(OCC=C(Cl)Cl)cc1Cl.
What is the InChIKey of 2-[2-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-3-(trifluoromethyl)pyridine?
The InChIKey is FSQAXLPBYUQLLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Cl3F3NO3/c18-13-10-11(25-7-5-15(19)20)3-4-14(13)26-8-9-27-16-12(17(21,22)23)2-1-6-24-16/h1-6,10H,7-9H2.
What are the key properties of 2-[2-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-3-(trifluoromethyl)pyridine?
2-[2-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-3-(trifluoromethyl)pyridine has a molecular weight of 442.65 g/mol, XLogP of 5.91, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-3-(trifluoromethyl)pyridine is sourced from PubChem (CID 142242953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).