C36H50 — CID 142243189
ethane;5-ethyl-1,2,3,4-tetrahydronaphthalene;bis(6-methyl-1,2,3,4-tetrahydronaphthalene) (PubChem CID 142243189) has the molecular formula C36H50 and a molecular weight of 482.80 g/mol. Its IUPAC name is ethane;5-ethyl-1,2,3,4-tetrahydronaphthalene;bis(6-methyl-1,2,3,4-tetrahydronaphthalene).
| Compound Name | ethane;5-ethyl-1,2,3,4-tetrahydronaphthalene;bis(6-methyl-1,2,3,4-tetrahydronaphthalene) |
|---|---|
| PubChem CID | 142243189 |
| Molecular Formula | C36H50 |
| Molecular Weight | 482.80 g/mol |
| Exact Mass | 482.39 |
| IUPAC Name | ethane;5-ethyl-1,2,3,4-tetrahydronaphthalene;bis(6-methyl-1,2,3,4-tetrahydronaphthalene) |
| SMILES | CC.CCc1cccc2c1CCCC2.Cc1ccc2c(c1)CCCC2.Cc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C12H16.2C11H14.C2H6/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;2*1-9-6-7-10-4-2-3-5-11(10)8-9;1-2/h5,7-8H,2-4,6,9H2,1H3;2*6-8H,2-5H2,1H3;1-2H3 |
| InChIKey | MFTBCDWNUDPSIQ-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.80 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |