C5ClCuF6 — CID 14224327
1-chloro-3,3,4,4,5,5-hexafluorocyclopentene;copper(1+) (PubChem CID 14224327) has the molecular formula C5ClCuF6 and a molecular weight of 273.04 g/mol. Its IUPAC name is 1-chloro-3,3,4,4,5,5-hexafluorocyclopentene;copper(1+).
| Compound Name | 1-chloro-3,3,4,4,5,5-hexafluorocyclopentene;copper(1+) |
|---|---|
| PubChem CID | 14224327 |
| Molecular Formula | C5ClCuF6 |
| Molecular Weight | 273.04 g/mol |
| Exact Mass | 271.89 |
| IUPAC Name | 1-chloro-3,3,4,4,5,5-hexafluorocyclopentene;copper(1+) |
| SMILES | FC1(F)[C-]=C(Cl)C(F)(F)C1(F)F.[Cu+] |
| InChI | InChI=1S/C5ClF6.Cu/c6-2-1-3(7,8)5(11,12)4(2,9)10;/q-1;+1 |
| InChIKey | ATIBWJGUMXRKKO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.04 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|