C6H3ClF6 — CID 14224329
1-chloro-3,3,4,4,5,5-hexafluoro-2-methylcyclopentene (PubChem CID 14224329) has the molecular formula C6H3ClF6 and a molecular weight of 224.53 g/mol. Its IUPAC name is 1-chloro-3,3,4,4,5,5-hexafluoro-2-methylcyclopentene.
| Compound Name | 1-chloro-3,3,4,4,5,5-hexafluoro-2-methylcyclopentene |
|---|---|
| PubChem CID | 14224329 |
| Molecular Formula | C6H3ClF6 |
| Molecular Weight | 224.53 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | 1-chloro-3,3,4,4,5,5-hexafluoro-2-methylcyclopentene |
| SMILES | CC1=C(Cl)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6H3ClF6/c1-2-3(7)5(10,11)6(12,13)4(2,8)9/h1H3 |
| InChIKey | HWHKCMWGBDHXLB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|