C24H30N4O4S — CID 142243713
N-cyclohexyl-1-(4,4-dihydroxybutyl)-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide (PubChem CID 142243713) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is N-cyclohexyl-1-(4,4-dihydroxybutyl)-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide.
| Compound Name | N-cyclohexyl-1-(4,4-dihydroxybutyl)-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 142243713 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N-cyclohexyl-1-(4,4-dihydroxybutyl)-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide |
| SMILES | CN(C(=O)c1ccc2c(c1)nc(NC(=O)c1cccs1)n2CCCC(O)O)C1CCCCC1 |
| InChI | InChI=1S/C24H30N4O4S/c1-27(17-7-3-2-4-8-17)23(32)16-11-12-19-18(15-16)25-24(28(19)13-5-10-21(29)30)26-22(31)20-9-6-14-33-20/h6,9,11-12,14-15,17,21,29-30H,2-5,7-8,10,13H2,1H3,(H,25,26,31) |
| InChIKey | ZDJVSOWLHFIBRU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|