C25H33N5O3S — CID 142243777
N-cyclohexyl-1-[3-(dimethylamino)-3-hydroxypropyl]-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide (PubChem CID 142243777) has the molecular formula C25H33N5O3S and a molecular weight of 483.64 g/mol. Its IUPAC name is N-cyclohexyl-1-[3-(dimethylamino)-3-hydroxypropyl]-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide.
| Compound Name | N-cyclohexyl-1-[3-(dimethylamino)-3-hydroxypropyl]-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 142243777 |
| Molecular Formula | C25H33N5O3S |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | N-cyclohexyl-1-[3-(dimethylamino)-3-hydroxypropyl]-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide |
| SMILES | CN(C)C(O)CCn1c(NC(=O)c2cccs2)nc2cc(C(=O)N(C)C3CCCCC3)ccc21 |
| InChI | InChI=1S/C25H33N5O3S/c1-28(2)22(31)13-14-30-20-12-11-17(24(33)29(3)18-8-5-4-6-9-18)16-19(20)26-25(30)27-23(32)21-10-7-15-34-21/h7,10-12,15-16,18,22,31H,4-6,8-9,13-14H2,1-3H3,(H,26,27,32) |
| InChIKey | OMLILHVOIDFRFU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|