C30H48O6 — CID 142245038
(11E,13E,16Z)-15-[(4,6-dimethyloxan-2-yl)oxymethyl]-7,9-diethyl-16-ethylidene-4-hydroxy-13-methyl-1-oxacyclohexadeca-11,13-diene-2,10-dione (PubChem CID 142245038) has the molecular formula C30H48O6 and a molecular weight of 504.71 g/mol. Its IUPAC name is (11E,13E,16Z)-15-[(4,6-dimethyloxan-2-yl)oxymethyl]-7,9-diethyl-16-ethylidene-4-hydroxy-13-methyl-1-oxacyclohexadeca-11,13-diene-2,10-dione.
| Compound Name | (11E,13E,16Z)-15-[(4,6-dimethyloxan-2-yl)oxymethyl]-7,9-diethyl-16-ethylidene-4-hydroxy-13-methyl-1-oxacyclohexadeca-11,13-diene-2,10-dione |
|---|---|
| PubChem CID | 142245038 |
| Molecular Formula | C30H48O6 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | (11E,13E,16Z)-15-[(4,6-dimethyloxan-2-yl)oxymethyl]-7,9-diethyl-16-ethylidene-4-hydroxy-13-methyl-1-oxacyclohexadeca-11,13-diene-2,10-dione |
| SMILES | C/C=C1\OC(=O)CC(O)CCC(CC)CC(CC)C(=O)/C=C/C(C)=C/C1COC1CC(C)CC(C)O1 |
| InChI | InChI=1S/C30H48O6/c1-7-23-11-12-26(31)18-29(33)36-28(9-3)25(19-34-30-16-21(5)14-22(6)35-30)15-20(4)10-13-27(32)24(8-2)17-23/h9-10,13,15,21-26,30-31H,7-8,11-12,14,16-19H2,1-6H3/b13-10+,20-15+,28-9- |
| InChIKey | MANUVSBAZODHDQ-ROYWCRCQSA-N |
| XLogP | 6.29 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |