About 4-[(Z)-4-ethenoxybut-3-en-2-yl]piperidine;2-methylpropan-1-ol
4-[(Z)-4-ethenoxybut-3-en-2-yl]piperidine;2-methylpropan-1-ol (PubChem CID 142245490) has the molecular formula C15H29NO2
and a molecular weight of 255.40 g/mol. Its IUPAC name is 4-[(Z)-4-ethenoxybut-3-en-2-yl]piperidine;2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 4-[(Z)-4-ethenoxybut-3-en-2-yl]piperidine;2-methylpropan-1-ol |
| PubChem CID | 142245490 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 4-[(Z)-4-ethenoxybut-3-en-2-yl]piperidine;2-methylpropan-1-ol |
| SMILES | C=CO/C=C\C(C)C1CCNCC1.CC(C)CO |
| InChI | InChI=1S/C11H19NO.C4H10O/c1-3-13-9-6-10(2)11-4-7-12-8-5-11;1-4(2)3-5/h3,6,9-12H,1,4-5,7-8H2,2H3;4-5H,3H2,1-2H3/b9-6-; |
| InChIKey | YRPJFYRNISCZOD-BORNJIKYSA-N |
| XLogP | 2.93 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-4-ethenoxybut-3-en-2-yl]piperidine;2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-4-ethenoxybut-3-en-2-yl]piperidine;2-methylpropan-1-ol?
The IUPAC name of 4-[(Z)-4-ethenoxybut-3-en-2-yl]piperidine;2-methylpropan-1-ol (CID 142245490) is 4-[(Z)-4-ethenoxybut-3-en-2-yl]piperidine;2-methylpropan-1-ol.
What is the SMILES notation for 4-[(Z)-4-ethenoxybut-3-en-2-yl]piperidine;2-methylpropan-1-ol?
The canonical SMILES for 4-[(Z)-4-ethenoxybut-3-en-2-yl]piperidine;2-methylpropan-1-ol is C=CO/C=C\C(C)C1CCNCC1.CC(C)CO.
What is the InChIKey of 4-[(Z)-4-ethenoxybut-3-en-2-yl]piperidine;2-methylpropan-1-ol?
The InChIKey is YRPJFYRNISCZOD-BORNJIKYSA-N. The full InChI is InChI=1S/C11H19NO.C4H10O/c1-3-13-9-6-10(2)11-4-7-12-8-5-11;1-4(2)3-5/h3,6,9-12H,1,4-5,7-8H2,2H3;4-5H,3H2,1-2H3/b9-6-;.
What are the key properties of 4-[(Z)-4-ethenoxybut-3-en-2-yl]piperidine;2-methylpropan-1-ol?
4-[(Z)-4-ethenoxybut-3-en-2-yl]piperidine;2-methylpropan-1-ol has a molecular weight of 255.40 g/mol, XLogP of 2.93, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-4-ethenoxybut-3-en-2-yl]piperidine;2-methylpropan-1-ol is sourced from PubChem (CID 142245490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).