C19H19F3N2O4 — CID 142245581
[(3R)-4-phenylpiperidin-3-yl] pyridine-4-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 142245581) has the molecular formula C19H19F3N2O4 and a molecular weight of 396.37 g/mol. Its IUPAC name is [(3R)-4-phenylpiperidin-3-yl] pyridine-4-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | [(3R)-4-phenylpiperidin-3-yl] pyridine-4-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 142245581 |
| Molecular Formula | C19H19F3N2O4 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | [(3R)-4-phenylpiperidin-3-yl] pyridine-4-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O[C@H]1CNCCC1c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C17H18N2O2.C2HF3O2/c20-17(14-6-9-18-10-7-14)21-16-12-19-11-8-15(16)13-4-2-1-3-5-13;3-2(4,5)1(6)7/h1-7,9-10,15-16,19H,8,11-12H2;(H,6,7)/t15?,16-;/m0./s1 |
| InChIKey | RZNKFFHLKXTOFB-UFUZRDLVSA-N |
| XLogP | 3.02 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |