C10H11NS2 — CID 142245671
5,6-dimethyl-2-methylsulfanyl-1,3-benzothiazole (PubChem CID 142245671) has the molecular formula C10H11NS2 and a molecular weight of 209.34 g/mol. Its IUPAC name is 5,6-dimethyl-2-methylsulfanyl-1,3-benzothiazole.
| Compound Name | 5,6-dimethyl-2-methylsulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 142245671 |
| Molecular Formula | C10H11NS2 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 5,6-dimethyl-2-methylsulfanyl-1,3-benzothiazole |
| SMILES | CSc1nc2cc(C)c(C)cc2s1 |
| InChI | InChI=1S/C10H11NS2/c1-6-4-8-9(5-7(6)2)13-10(11-8)12-3/h4-5H,1-3H3 |
| InChIKey | XNFZURPDEBVOLM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |