About 4H-1-benzazepine
4H-1-benzazepine (PubChem CID 142246259) has the molecular formula C10H9N
and a molecular weight of 143.19 g/mol. Its IUPAC name is 4H-1-benzazepine.
Molecular Properties
| Compound Name | 4H-1-benzazepine |
| PubChem CID | 142246259 |
| Molecular Formula | C10H9N |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 4H-1-benzazepine |
| SMILES | C1=CN=c2ccccc2=CC1 |
| InChI | InChI=1S/C10H9N/c1-2-7-10-9(5-1)6-3-4-8-11-10/h1-2,4-8H,3H2 |
| InChIKey | GZDFNOOZOGEXDS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4H-1-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-1-benzazepine?
The IUPAC name of 4H-1-benzazepine (CID 142246259) is 4H-1-benzazepine.
What is the SMILES notation for 4H-1-benzazepine?
The canonical SMILES for 4H-1-benzazepine is C1=CN=c2ccccc2=CC1.
What is the InChIKey of 4H-1-benzazepine?
The InChIKey is GZDFNOOZOGEXDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N/c1-2-7-10-9(5-1)6-3-4-8-11-10/h1-2,4-8H,3H2.
What are the key properties of 4H-1-benzazepine?
4H-1-benzazepine has a molecular weight of 143.19 g/mol, XLogP of 1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-1-benzazepine is sourced from PubChem (CID 142246259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).