C11H16FN — CID 142246394
(1Z,3E)-2-ethyl-3-[(Z)-3-fluoroprop-1-enyl]hexa-1,3,5-trien-1-amine (PubChem CID 142246394) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is (1Z,3E)-2-ethyl-3-[(Z)-3-fluoroprop-1-enyl]hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-2-ethyl-3-[(Z)-3-fluoroprop-1-enyl]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 142246394 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | (1Z,3E)-2-ethyl-3-[(Z)-3-fluoroprop-1-enyl]hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/CF)C(=C\N)/CC |
| InChI | InChI=1S/C11H16FN/c1-3-6-11(7-5-8-12)10(4-2)9-13/h3,5-7,9H,1,4,8,13H2,2H3/b7-5-,10-9-,11-6+ |
| InChIKey | JIWSRSVHCFOFHB-PQEFWJGLSA-N |
| XLogP | 2.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|