About 2-[6-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]phenol
2-[6-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]phenol (PubChem CID 142246938) has the molecular formula C20H12F3NO2
and a molecular weight of 355.32 g/mol. Its IUPAC name is 2-[6-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]phenol.
Molecular Properties
| Compound Name | 2-[6-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]phenol |
| PubChem CID | 142246938 |
| Molecular Formula | C20H12F3NO2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-[6-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nc2ccc(-c3ccccc3C(F)(F)F)cc2o1 |
| InChI | InChI=1S/C20H12F3NO2/c21-20(22,23)15-7-3-1-5-13(15)12-9-10-16-18(11-12)26-19(24-16)14-6-2-4-8-17(14)25/h1-11,25H |
| InChIKey | PZJZUNVFHDPZKJ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[6-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]phenol?
The IUPAC name of 2-[6-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]phenol (CID 142246938) is 2-[6-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]phenol.
What is the SMILES notation for 2-[6-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]phenol?
The canonical SMILES for 2-[6-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]phenol is Oc1ccccc1-c1nc2ccc(-c3ccccc3C(F)(F)F)cc2o1.
What is the InChIKey of 2-[6-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]phenol?
The InChIKey is PZJZUNVFHDPZKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12F3NO2/c21-20(22,23)15-7-3-1-5-13(15)12-9-10-16-18(11-12)26-19(24-16)14-6-2-4-8-17(14)25/h1-11,25H.
What are the key properties of 2-[6-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]phenol?
2-[6-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]phenol has a molecular weight of 355.32 g/mol, XLogP of 5.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]phenol is sourced from PubChem (CID 142246938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).