About 5-bromo-3-cyclopropyl-6-ethylpyrazin-2-amine;2,3-dihydro-1H-inden-2-ol
5-bromo-3-cyclopropyl-6-ethylpyrazin-2-amine;2,3-dihydro-1H-inden-2-ol (PubChem CID 142247235) has the molecular formula C18H22BrN3O
and a molecular weight of 376.30 g/mol. Its IUPAC name is 5-bromo-3-cyclopropyl-6-ethylpyrazin-2-amine;2,3-dihydro-1H-inden-2-ol.
Molecular Properties
| Compound Name | 5-bromo-3-cyclopropyl-6-ethylpyrazin-2-amine;2,3-dihydro-1H-inden-2-ol |
| PubChem CID | 142247235 |
| Molecular Formula | C18H22BrN3O |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 5-bromo-3-cyclopropyl-6-ethylpyrazin-2-amine;2,3-dihydro-1H-inden-2-ol |
| SMILES | CCc1nc(N)c(C2CC2)nc1Br.OC1Cc2ccccc2C1 |
| InChI | InChI=1S/C9H12BrN3.C9H10O/c1-2-6-8(10)13-7(5-3-4-5)9(11)12-6;10-9-5-7-3-1-2-4-8(7)6-9/h5H,2-4H2,1H3,(H2,11,12);1-4,9-10H,5-6H2 |
| InChIKey | UZOYTWAQFCJLSQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-3-cyclopropyl-6-ethylpyrazin-2-amine;2,3-dihydro-1H-inden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-cyclopropyl-6-ethylpyrazin-2-amine;2,3-dihydro-1H-inden-2-ol?
The IUPAC name of 5-bromo-3-cyclopropyl-6-ethylpyrazin-2-amine;2,3-dihydro-1H-inden-2-ol (CID 142247235) is 5-bromo-3-cyclopropyl-6-ethylpyrazin-2-amine;2,3-dihydro-1H-inden-2-ol.
What is the SMILES notation for 5-bromo-3-cyclopropyl-6-ethylpyrazin-2-amine;2,3-dihydro-1H-inden-2-ol?
The canonical SMILES for 5-bromo-3-cyclopropyl-6-ethylpyrazin-2-amine;2,3-dihydro-1H-inden-2-ol is CCc1nc(N)c(C2CC2)nc1Br.OC1Cc2ccccc2C1.
What is the InChIKey of 5-bromo-3-cyclopropyl-6-ethylpyrazin-2-amine;2,3-dihydro-1H-inden-2-ol?
The InChIKey is UZOYTWAQFCJLSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrN3.C9H10O/c1-2-6-8(10)13-7(5-3-4-5)9(11)12-6;10-9-5-7-3-1-2-4-8(7)6-9/h5H,2-4H2,1H3,(H2,11,12);1-4,9-10H,5-6H2.
What are the key properties of 5-bromo-3-cyclopropyl-6-ethylpyrazin-2-amine;2,3-dihydro-1H-inden-2-ol?
5-bromo-3-cyclopropyl-6-ethylpyrazin-2-amine;2,3-dihydro-1H-inden-2-ol has a molecular weight of 376.30 g/mol, XLogP of 3.41, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-cyclopropyl-6-ethylpyrazin-2-amine;2,3-dihydro-1H-inden-2-ol is sourced from PubChem (CID 142247235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).