About (1R)-1-[(3,6-diethylpyrazin-2-yl)amino]-1,3-dihydroinden-2-one
(1R)-1-[(3,6-diethylpyrazin-2-yl)amino]-1,3-dihydroinden-2-one (PubChem CID 142247240) has the molecular formula C17H19N3O
and a molecular weight of 281.36 g/mol. Its IUPAC name is (1R)-1-[(3,6-diethylpyrazin-2-yl)amino]-1,3-dihydroinden-2-one.
Molecular Properties
| Compound Name | (1R)-1-[(3,6-diethylpyrazin-2-yl)amino]-1,3-dihydroinden-2-one |
| PubChem CID | 142247240 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (1R)-1-[(3,6-diethylpyrazin-2-yl)amino]-1,3-dihydroinden-2-one |
| SMILES | CCc1cnc(CC)c(N[C@H]2C(=O)Cc3ccccc32)n1 |
| InChI | InChI=1S/C17H19N3O/c1-3-12-10-18-14(4-2)17(19-12)20-16-13-8-6-5-7-11(13)9-15(16)21/h5-8,10,16H,3-4,9H2,1-2H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | IMEFEQYPRGLZDC-MRXNPFEDSA-N |
| XLogP | 2.88 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R)-1-[(3,6-diethylpyrazin-2-yl)amino]-1,3-dihydroinden-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[(3,6-diethylpyrazin-2-yl)amino]-1,3-dihydroinden-2-one?
The IUPAC name of (1R)-1-[(3,6-diethylpyrazin-2-yl)amino]-1,3-dihydroinden-2-one (CID 142247240) is (1R)-1-[(3,6-diethylpyrazin-2-yl)amino]-1,3-dihydroinden-2-one.
What is the SMILES notation for (1R)-1-[(3,6-diethylpyrazin-2-yl)amino]-1,3-dihydroinden-2-one?
The canonical SMILES for (1R)-1-[(3,6-diethylpyrazin-2-yl)amino]-1,3-dihydroinden-2-one is CCc1cnc(CC)c(N[C@H]2C(=O)Cc3ccccc32)n1.
What is the InChIKey of (1R)-1-[(3,6-diethylpyrazin-2-yl)amino]-1,3-dihydroinden-2-one?
The InChIKey is IMEFEQYPRGLZDC-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H19N3O/c1-3-12-10-18-14(4-2)17(19-12)20-16-13-8-6-5-7-11(13)9-15(16)21/h5-8,10,16H,3-4,9H2,1-2H3,(H,19,20)/t16-/m1/s1.
What are the key properties of (1R)-1-[(3,6-diethylpyrazin-2-yl)amino]-1,3-dihydroinden-2-one?
(1R)-1-[(3,6-diethylpyrazin-2-yl)amino]-1,3-dihydroinden-2-one has a molecular weight of 281.36 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[(3,6-diethylpyrazin-2-yl)amino]-1,3-dihydroinden-2-one is sourced from PubChem (CID 142247240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).