About 5-bromo-3,6-diethylpyrazin-2-amine;2,3-dihydro-1H-indene;ethane
5-bromo-3,6-diethylpyrazin-2-amine;2,3-dihydro-1H-indene;ethane (PubChem CID 142247300) has the molecular formula C19H28BrN3
and a molecular weight of 378.36 g/mol. Its IUPAC name is 5-bromo-3,6-diethylpyrazin-2-amine;2,3-dihydro-1H-indene;ethane.
Molecular Properties
| Compound Name | 5-bromo-3,6-diethylpyrazin-2-amine;2,3-dihydro-1H-indene;ethane |
| PubChem CID | 142247300 |
| Molecular Formula | C19H28BrN3 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 5-bromo-3,6-diethylpyrazin-2-amine;2,3-dihydro-1H-indene;ethane |
| SMILES | CC.CCc1nc(Br)c(CC)nc1N.c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C9H10.C8H12BrN3.C2H6/c1-2-5-9-7-3-6-8(9)4-1;1-3-5-7(9)11-6(4-2)8(10)12-5;1-2/h1-2,4-5H,3,6-7H2;3-4H2,1-2H3,(H2,10,12);1-2H3 |
| InChIKey | FHSCMVIIFTUJML-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-3,6-diethylpyrazin-2-amine;2,3-dihydro-1H-indene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3,6-diethylpyrazin-2-amine;2,3-dihydro-1H-indene;ethane?
The IUPAC name of 5-bromo-3,6-diethylpyrazin-2-amine;2,3-dihydro-1H-indene;ethane (CID 142247300) is 5-bromo-3,6-diethylpyrazin-2-amine;2,3-dihydro-1H-indene;ethane.
What is the SMILES notation for 5-bromo-3,6-diethylpyrazin-2-amine;2,3-dihydro-1H-indene;ethane?
The canonical SMILES for 5-bromo-3,6-diethylpyrazin-2-amine;2,3-dihydro-1H-indene;ethane is CC.CCc1nc(Br)c(CC)nc1N.c1ccc2c(c1)CCC2.
What is the InChIKey of 5-bromo-3,6-diethylpyrazin-2-amine;2,3-dihydro-1H-indene;ethane?
The InChIKey is FHSCMVIIFTUJML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C8H12BrN3.C2H6/c1-2-5-9-7-3-6-8(9)4-1;1-3-5-7(9)11-6(4-2)8(10)12-5;1-2/h1-2,4-5H,3,6-7H2;3-4H2,1-2H3,(H2,10,12);1-2H3.
What are the key properties of 5-bromo-3,6-diethylpyrazin-2-amine;2,3-dihydro-1H-indene;ethane?
5-bromo-3,6-diethylpyrazin-2-amine;2,3-dihydro-1H-indene;ethane has a molecular weight of 378.36 g/mol, XLogP of 5.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3,6-diethylpyrazin-2-amine;2,3-dihydro-1H-indene;ethane is sourced from PubChem (CID 142247300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).