About 1-[5-(dimethylamino)cyclohepta-1,4,6-trien-1-yl]-2-methyl-4-(propylamino)butan-1-one;ethane
1-[5-(dimethylamino)cyclohepta-1,4,6-trien-1-yl]-2-methyl-4-(propylamino)butan-1-one;ethane (PubChem CID 142247465) has the molecular formula C19H34N2O
and a molecular weight of 306.49 g/mol. Its IUPAC name is 1-[5-(dimethylamino)cyclohepta-1,4,6-trien-1-yl]-2-methyl-4-(propylamino)butan-1-one;ethane.
Molecular Properties
| Compound Name | 1-[5-(dimethylamino)cyclohepta-1,4,6-trien-1-yl]-2-methyl-4-(propylamino)butan-1-one;ethane |
| PubChem CID | 142247465 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 1-[5-(dimethylamino)cyclohepta-1,4,6-trien-1-yl]-2-methyl-4-(propylamino)butan-1-one;ethane |
| SMILES | CC.CCCNCCC(C)C(=O)C1=CCC=C(N(C)C)C=C1 |
| InChI | InChI=1S/C17H28N2O.C2H6/c1-5-12-18-13-11-14(2)17(20)15-7-6-8-16(10-9-15)19(3)4;1-2/h7-10,14,18H,5-6,11-13H2,1-4H3;1-2H3 |
| InChIKey | ZXOLWZWWNFOJOI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(dimethylamino)cyclohepta-1,4,6-trien-1-yl]-2-methyl-4-(propylamino)butan-1-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(dimethylamino)cyclohepta-1,4,6-trien-1-yl]-2-methyl-4-(propylamino)butan-1-one;ethane?
The IUPAC name of 1-[5-(dimethylamino)cyclohepta-1,4,6-trien-1-yl]-2-methyl-4-(propylamino)butan-1-one;ethane (CID 142247465) is 1-[5-(dimethylamino)cyclohepta-1,4,6-trien-1-yl]-2-methyl-4-(propylamino)butan-1-one;ethane.
What is the SMILES notation for 1-[5-(dimethylamino)cyclohepta-1,4,6-trien-1-yl]-2-methyl-4-(propylamino)butan-1-one;ethane?
The canonical SMILES for 1-[5-(dimethylamino)cyclohepta-1,4,6-trien-1-yl]-2-methyl-4-(propylamino)butan-1-one;ethane is CC.CCCNCCC(C)C(=O)C1=CCC=C(N(C)C)C=C1.
What is the InChIKey of 1-[5-(dimethylamino)cyclohepta-1,4,6-trien-1-yl]-2-methyl-4-(propylamino)butan-1-one;ethane?
The InChIKey is ZXOLWZWWNFOJOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O.C2H6/c1-5-12-18-13-11-14(2)17(20)15-7-6-8-16(10-9-15)19(3)4;1-2/h7-10,14,18H,5-6,11-13H2,1-4H3;1-2H3.
What are the key properties of 1-[5-(dimethylamino)cyclohepta-1,4,6-trien-1-yl]-2-methyl-4-(propylamino)butan-1-one;ethane?
1-[5-(dimethylamino)cyclohepta-1,4,6-trien-1-yl]-2-methyl-4-(propylamino)butan-1-one;ethane has a molecular weight of 306.49 g/mol, XLogP of 3.94, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(dimethylamino)cyclohepta-1,4,6-trien-1-yl]-2-methyl-4-(propylamino)butan-1-one;ethane is sourced from PubChem (CID 142247465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).