C27H31N3O8S4 — CID 142247613
S-hydroxy 2-[5-[(Z)-3-(ethylsulfonylamino)-1-[4-(methoxymethoxy)phenyl]prop-1-en-2-yl]-3-[(2-methylsulfanylphenyl)methyl]-2,6-dioxo-4-sulfanylpyrimidin-1-yl]ethanethioate (PubChem CID 142247613) has the molecular formula C27H31N3O8S4 and a molecular weight of 653.83 g/mol. Its IUPAC name is S-hydroxy 2-[5-[(Z)-3-(ethylsulfonylamino)-1-[4-(methoxymethoxy)phenyl]prop-1-en-2-yl]-3-[(2-methylsulfanylphenyl)methyl]-2,6-dioxo-4-sulfanylpyrimidin-1-yl]ethanethioate.
| Compound Name | S-hydroxy 2-[5-[(Z)-3-(ethylsulfonylamino)-1-[4-(methoxymethoxy)phenyl]prop-1-en-2-yl]-3-[(2-methylsulfanylphenyl)methyl]-2,6-dioxo-4-sulfanylpyrimidin-1-yl]ethanethioate |
|---|---|
| PubChem CID | 142247613 |
| Molecular Formula | C27H31N3O8S4 |
| Molecular Weight | 653.83 g/mol |
| Exact Mass | 653.10 |
| IUPAC Name | S-hydroxy 2-[5-[(Z)-3-(ethylsulfonylamino)-1-[4-(methoxymethoxy)phenyl]prop-1-en-2-yl]-3-[(2-methylsulfanylphenyl)methyl]-2,6-dioxo-4-sulfanylpyrimidin-1-yl]ethanethioate |
| SMILES | CCS(=O)(=O)NC/C(=C\c1ccc(OCOC)cc1)c1c(S)n(Cc2ccccc2SC)c(=O)n(CC(=O)SO)c1=O |
| InChI | InChI=1S/C27H31N3O8S4/c1-4-42(35,36)28-14-20(13-18-9-11-21(12-10-18)38-17-37-2)24-25(32)29(16-23(31)41-34)27(33)30(26(24)39)15-19-7-5-6-8-22(19)40-3/h5-13,28,34,39H,4,14-17H2,1-3H3/b20-13+ |
| InChIKey | FXSYZCDZFVVBCS-DEDYPNTBSA-N |
| XLogP | 3.26 |
| TPSA | 145.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.83 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|