C24H21N3O — CID 142247638
(E)-N-[4-amino-2-[(3E)-hexa-1,3,5-trien-3-yl]quinolin-6-yl]-3-phenylprop-2-enamide (PubChem CID 142247638) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is (E)-N-[4-amino-2-[(3E)-hexa-1,3,5-trien-3-yl]quinolin-6-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-amino-2-[(3E)-hexa-1,3,5-trien-3-yl]quinolin-6-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 142247638 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (E)-N-[4-amino-2-[(3E)-hexa-1,3,5-trien-3-yl]quinolin-6-yl]-3-phenylprop-2-enamide |
| SMILES | C=C/C=C(\C=C)c1cc(N)c2cc(NC(=O)/C=C/c3ccccc3)ccc2n1 |
| InChI | InChI=1S/C24H21N3O/c1-3-8-18(4-2)23-16-21(25)20-15-19(12-13-22(20)27-23)26-24(28)14-11-17-9-6-5-7-10-17/h3-16H,1-2H2,(H2,25,27)(H,26,28)/b14-11+,18-8+ |
| InChIKey | UTFDHBFVCTVTOQ-XCGAKDHTSA-N |
| XLogP | 5.22 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|