C15H26O4 — CID 142247778
(6-propan-2-yloxan-2-yl) 6-methyloxane-2-carboxylate (PubChem CID 142247778) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (6-propan-2-yloxan-2-yl) 6-methyloxane-2-carboxylate.
| Compound Name | (6-propan-2-yloxan-2-yl) 6-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 142247778 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (6-propan-2-yloxan-2-yl) 6-methyloxane-2-carboxylate |
| SMILES | CC1CCCC(C(=O)OC2CCCC(C(C)C)O2)O1 |
| InChI | InChI=1S/C15H26O4/c1-10(2)12-7-5-9-14(18-12)19-15(16)13-8-4-6-11(3)17-13/h10-14H,4-9H2,1-3H3 |
| InChIKey | IWSPYWGVYITGCH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |